C13H23N5S — CID 107547215
2-[1-(diethylamino)propan-2-ylamino]-6-methylpyrimidine-4-carbothioamide (PubChem CID 107547215) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 2-[1-(diethylamino)propan-2-ylamino]-6-methylpyrimidine-4-carbothioamide.
| Compound Name | 2-[1-(diethylamino)propan-2-ylamino]-6-methylpyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547215 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-[1-(diethylamino)propan-2-ylamino]-6-methylpyrimidine-4-carbothioamide |
| SMILES | CCN(CC)CC(C)Nc1nc(C)cc(C(N)=S)n1 |
| InChI | InChI=1S/C13H23N5S/c1-5-18(6-2)8-10(4)16-13-15-9(3)7-11(17-13)12(14)19/h7,10H,5-6,8H2,1-4H3,(H2,14,19)(H,15,16,17) |
| InChIKey | QQOWOOZXSZUWCH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|