C13H13N3O2S — CID 62928401
1-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4-methylpyrazine-2,3-dione (PubChem CID 62928401) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4-methylpyrazine-2,3-dione.
| Compound Name | 1-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 62928401 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4-methylpyrazine-2,3-dione |
| SMILES | Cn1ccn(Cc2ccc(C#CCN)s2)c(=O)c1=O |
| InChI | InChI=1S/C13H13N3O2S/c1-15-7-8-16(13(18)12(15)17)9-11-5-4-10(19-11)3-2-6-14/h4-5,7-8H,6,9,14H2,1H3 |
| InChIKey | GFYMLPDEGVDLQO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|