C12H12BrFN2O2 — CID 62928955
1-[(2-bromo-4-fluorophenyl)methyl]-4-methylpiperazine-2,3-dione (PubChem CID 62928955) has the molecular formula C12H12BrFN2O2 and a molecular weight of 315.14 g/mol. Its IUPAC name is 1-[(2-bromo-4-fluorophenyl)methyl]-4-methylpiperazine-2,3-dione.
| Compound Name | 1-[(2-bromo-4-fluorophenyl)methyl]-4-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 62928955 |
| Molecular Formula | C12H12BrFN2O2 |
| Molecular Weight | 315.14 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 1-[(2-bromo-4-fluorophenyl)methyl]-4-methylpiperazine-2,3-dione |
| SMILES | CN1CCN(Cc2ccc(F)cc2Br)C(=O)C1=O |
| InChI | InChI=1S/C12H12BrFN2O2/c1-15-4-5-16(12(18)11(15)17)7-8-2-3-9(14)6-10(8)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | TVUWSDFHZVCUKG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.14 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|