C13H22N4O2S — CID 62930000
5-(4,4-dimethylpiperidin-1-yl)sulfonyl-N-ethylpyrimidin-2-amine (PubChem CID 62930000) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-(4,4-dimethylpiperidin-1-yl)sulfonyl-N-ethylpyrimidin-2-amine.
| Compound Name | 5-(4,4-dimethylpiperidin-1-yl)sulfonyl-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 62930000 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 5-(4,4-dimethylpiperidin-1-yl)sulfonyl-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(S(=O)(=O)N2CCC(C)(C)CC2)cn1 |
| InChI | InChI=1S/C13H22N4O2S/c1-4-14-12-15-9-11(10-16-12)20(18,19)17-7-5-13(2,3)6-8-17/h9-10H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | TWTBSGVQHVQLRB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |