C17H24ClNO2 — CID 62933687
10-chloro-N,14,14-trimethyl-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-trien-16-amine (PubChem CID 62933687) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 10-chloro-N,14,14-trimethyl-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-trien-16-amine.
| Compound Name | 10-chloro-N,14,14-trimethyl-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-trien-16-amine |
|---|---|
| PubChem CID | 62933687 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 10-chloro-N,14,14-trimethyl-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-trien-16-amine |
| SMILES | CNC1CC(C)(C)CCc2c(Cl)cc3c(c21)OCCCO3 |
| InChI | InChI=1S/C17H24ClNO2/c1-17(2)6-5-11-12(18)9-14-16(21-8-4-7-20-14)15(11)13(10-17)19-3/h9,13,19H,4-8,10H2,1-3H3 |
| InChIKey | VGTVKNUWEXAQNI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |