C14H18ClNO2 — CID 79838512
6-chloro-N,7,7-trimethyl-2,3,8,9-tetrahydrocyclopenta[h][1,4]benzodioxin-9-amine (PubChem CID 79838512) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-chloro-N,7,7-trimethyl-2,3,8,9-tetrahydrocyclopenta[h][1,4]benzodioxin-9-amine.
| Compound Name | 6-chloro-N,7,7-trimethyl-2,3,8,9-tetrahydrocyclopenta[h][1,4]benzodioxin-9-amine |
|---|---|
| PubChem CID | 79838512 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-chloro-N,7,7-trimethyl-2,3,8,9-tetrahydrocyclopenta[h][1,4]benzodioxin-9-amine |
| SMILES | CNC1CC(C)(C)c2c(Cl)cc3c(c21)OCCO3 |
| InChI | InChI=1S/C14H18ClNO2/c1-14(2)7-9(16-3)11-12(14)8(15)6-10-13(11)18-5-4-17-10/h6,9,16H,4-5,7H2,1-3H3 |
| InChIKey | SWUUYIUBHXTSTQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |