C15H25N3O3 — CID 62939090
methyl 4-methyl-2-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]amino]pentanoate (PubChem CID 62939090) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is methyl 4-methyl-2-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]amino]pentanoate |
|---|---|
| PubChem CID | 62939090 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | methyl 4-methyl-2-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)Nc1nccn(CC(C)C)c1=O |
| InChI | InChI=1S/C15H25N3O3/c1-10(2)8-12(15(20)21-5)17-13-14(19)18(7-6-16-13)9-11(3)4/h6-7,10-12H,8-9H2,1-5H3,(H,16,17) |
| InChIKey | JZQBXSONEUNCJB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |