C15H20F2O3 — CID 62942204
5-(2-ethoxy-5-methylphenyl)-5,5-difluoro-3-methylpentanoic acid (PubChem CID 62942204) has the molecular formula C15H20F2O3 and a molecular weight of 286.32 g/mol. Its IUPAC name is 5-(2-ethoxy-5-methylphenyl)-5,5-difluoro-3-methylpentanoic acid.
| Compound Name | 5-(2-ethoxy-5-methylphenyl)-5,5-difluoro-3-methylpentanoic acid |
|---|---|
| PubChem CID | 62942204 |
| Molecular Formula | C15H20F2O3 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5-(2-ethoxy-5-methylphenyl)-5,5-difluoro-3-methylpentanoic acid |
| SMILES | CCOc1ccc(C)cc1C(F)(F)CC(C)CC(=O)O |
| InChI | InChI=1S/C15H20F2O3/c1-4-20-13-6-5-10(2)7-12(13)15(16,17)9-11(3)8-14(18)19/h5-7,11H,4,8-9H2,1-3H3,(H,18,19) |
| InChIKey | SMSOXDKCTKYBLD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |