C26H26N2O2 — CID 629432
ethyl 2-(3-methyl-4,4-diphenylquinazolin-2-yl)propanoate (PubChem CID 629432) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl 2-(3-methyl-4,4-diphenylquinazolin-2-yl)propanoate.
| Compound Name | ethyl 2-(3-methyl-4,4-diphenylquinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 629432 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethyl 2-(3-methyl-4,4-diphenylquinazolin-2-yl)propanoate |
| SMILES | CCOC(=O)C(C)C1=Nc2ccccc2C(c2ccccc2)(c2ccccc2)N1C |
| InChI | InChI=1S/C26H26N2O2/c1-4-30-25(29)19(2)24-27-23-18-12-11-17-22(23)26(28(24)3,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-19H,4H2,1-3H3 |
| InChIKey | VJLMRVABDLGQGO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |