C30H29NO4 — CID 138978052
diethyl 1-methyl-2,2,6-triphenylpyridine-3,5-dicarboxylate (PubChem CID 138978052) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is diethyl 1-methyl-2,2,6-triphenylpyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-methyl-2,2,6-triphenylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 138978052 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | diethyl 1-methyl-2,2,6-triphenylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(C(=O)OCC)=C(c2ccccc2)N(C)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29NO4/c1-4-34-28(32)25-21-26(29(33)35-5-2)30(23-17-11-7-12-18-23,24-19-13-8-14-20-24)31(3)27(25)22-15-9-6-10-16-22/h6-21H,4-5H2,1-3H3 |
| InChIKey | SFQDHNGHTYGVEW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |