C11H15N3O5S — CID 62943650
1-[2-(methylamino)-5-nitrophenyl]sulfonylpyrrolidin-3-ol (PubChem CID 62943650) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-[2-(methylamino)-5-nitrophenyl]sulfonylpyrrolidin-3-ol.
| Compound Name | 1-[2-(methylamino)-5-nitrophenyl]sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 62943650 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[2-(methylamino)-5-nitrophenyl]sulfonylpyrrolidin-3-ol |
| SMILES | CNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C11H15N3O5S/c1-12-10-3-2-8(14(16)17)6-11(10)20(18,19)13-5-4-9(15)7-13/h2-3,6,9,12,15H,4-5,7H2,1H3 |
| InChIKey | CCWZWLSZJIJGMR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|