C12H17N3O5S — CID 62150394
N-methyl-2-(2-methylmorpholin-4-yl)sulfonyl-5-nitroaniline (PubChem CID 62150394) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-methyl-2-(2-methylmorpholin-4-yl)sulfonyl-5-nitroaniline.
| Compound Name | N-methyl-2-(2-methylmorpholin-4-yl)sulfonyl-5-nitroaniline |
|---|---|
| PubChem CID | 62150394 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-methyl-2-(2-methylmorpholin-4-yl)sulfonyl-5-nitroaniline |
| SMILES | CNc1cc([N+](=O)[O-])ccc1S(=O)(=O)N1CCOC(C)C1 |
| InChI | InChI=1S/C12H17N3O5S/c1-9-8-14(5-6-20-9)21(18,19)12-4-3-10(15(16)17)7-11(12)13-2/h3-4,7,9,13H,5-6,8H2,1-2H3 |
| InChIKey | MRFWPTGPAUFEAK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|