C16H19NO4 — CID 62946930
3-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbenzoic acid (PubChem CID 62946930) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbenzoic acid.
| Compound Name | 3-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 62946930 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-2-methylbenzoic acid |
| SMILES | CCC1(CC)CC(=O)N(c2cccc(C(=O)O)c2C)C1=O |
| InChI | InChI=1S/C16H19NO4/c1-4-16(5-2)9-13(18)17(15(16)21)12-8-6-7-11(10(12)3)14(19)20/h6-8H,4-5,9H2,1-3H3,(H,19,20) |
| InChIKey | JOVXKQLVYHSWOW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|