C11H10FN5OS — CID 62949422
2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-fluorophenyl)acetamide (PubChem CID 62949422) has the molecular formula C11H10FN5OS and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 62949422 |
| Molecular Formula | C11H10FN5OS |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-fluorophenyl)acetamide |
| SMILES | NC(=S)c1ncn(CC(=O)Nc2ccccc2F)n1 |
| InChI | InChI=1S/C11H10FN5OS/c12-7-3-1-2-4-8(7)15-9(18)5-17-6-14-11(16-17)10(13)19/h1-4,6H,5H2,(H2,13,19)(H,15,18) |
| InChIKey | ZMJFCSFUAZAEOD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|