C8H14N4 — CID 62952024
(1-cyclopentyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 62952024) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is (1-cyclopentyl-1,2,4-triazol-3-yl)methanamine.
| Compound Name | (1-cyclopentyl-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 62952024 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (1-cyclopentyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | NCc1ncn(C2CCCC2)n1 |
| InChI | InChI=1S/C8H14N4/c9-5-8-10-6-12(11-8)7-3-1-2-4-7/h6-7H,1-5,9H2 |
| InChIKey | XAVGTCMOJNVBRQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |