C10H14N4 — CID 82924529
1-cycloheptyl-1,2,4-triazole-3-carbonitrile (PubChem CID 82924529) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-cycloheptyl-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-cycloheptyl-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 82924529 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-cycloheptyl-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(C2CCCCCC2)n1 |
| InChI | InChI=1S/C10H14N4/c11-7-10-12-8-14(13-10)9-5-3-1-2-4-6-9/h8-9H,1-6H2 |
| InChIKey | BFLWHSCRGRIBOC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |