C11H13N5 — CID 62951230
1-(2-cyanocycloheptyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 62951230) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-(2-cyanocycloheptyl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(2-cyanocycloheptyl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 62951230 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-(2-cyanocycloheptyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(C2CCCCCC2C#N)n1 |
| InChI | InChI=1S/C11H13N5/c12-6-9-4-2-1-3-5-10(9)16-8-14-11(7-13)15-16/h8-10H,1-5H2 |
| InChIKey | VJBIWIGCOKHOCT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |