C12H14N4 — CID 112595680
1-cycloheptylimidazole-4,5-dicarbonitrile (PubChem CID 112595680) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-cycloheptylimidazole-4,5-dicarbonitrile.
| Compound Name | 1-cycloheptylimidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595680 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-cycloheptylimidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(C2CCCCCC2)c1C#N |
| InChI | InChI=1S/C12H14N4/c13-7-11-12(8-14)16(9-15-11)10-5-3-1-2-4-6-10/h9-10H,1-6H2 |
| InChIKey | XQFCGZDJDURIFH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |