C13H17FN2 — CID 62952128
2-(3-fluoroanilino)-4,4-dimethylpentanenitrile (PubChem CID 62952128) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-(3-fluoroanilino)-4,4-dimethylpentanenitrile.
| Compound Name | 2-(3-fluoroanilino)-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 62952128 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-(3-fluoroanilino)-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(C)CC(C#N)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2/c1-13(2,3)8-12(9-15)16-11-6-4-5-10(14)7-11/h4-7,12,16H,8H2,1-3H3 |
| InChIKey | PAUXTKIHVCPIQX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |