C13H23N3O5 — CID 62953322
methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]acetate (PubChem CID 62953322) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 62953322 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)CC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H23N3O5/c1-14-4-6-16(7-5-14)11(17)8-15(9-12(18)20-2)10-13(19)21-3/h4-10H2,1-3H3 |
| InChIKey | LWINHWSYBPGDMA-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |