C14H15F4N3 — CID 62955979
4-fluoro-N-[(1-propylimidazol-2-yl)methyl]-3-(trifluoromethyl)aniline (PubChem CID 62955979) has the molecular formula C14H15F4N3 and a molecular weight of 301.29 g/mol. Its IUPAC name is 4-fluoro-N-[(1-propylimidazol-2-yl)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-fluoro-N-[(1-propylimidazol-2-yl)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 62955979 |
| Molecular Formula | C14H15F4N3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-fluoro-N-[(1-propylimidazol-2-yl)methyl]-3-(trifluoromethyl)aniline |
| SMILES | CCCn1ccnc1CNc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F4N3/c1-2-6-21-7-5-19-13(21)9-20-10-3-4-12(15)11(8-10)14(16,17)18/h3-5,7-8,20H,2,6,9H2,1H3 |
| InChIKey | LWVDOHBQSZTPOF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |