C16H22ClN3O — CID 62955275
3-chloro-4-propoxy-N-[(1-propylimidazol-2-yl)methyl]aniline (PubChem CID 62955275) has the molecular formula C16H22ClN3O and a molecular weight of 307.83 g/mol. Its IUPAC name is 3-chloro-4-propoxy-N-[(1-propylimidazol-2-yl)methyl]aniline.
| Compound Name | 3-chloro-4-propoxy-N-[(1-propylimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 62955275 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-chloro-4-propoxy-N-[(1-propylimidazol-2-yl)methyl]aniline |
| SMILES | CCCOc1ccc(NCc2nccn2CCC)cc1Cl |
| InChI | InChI=1S/C16H22ClN3O/c1-3-8-20-9-7-18-16(20)12-19-13-5-6-15(14(17)11-13)21-10-4-2/h5-7,9,11,19H,3-4,8,10,12H2,1-2H3 |
| InChIKey | RWPWTLCFCOFWIX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|