C15H21N3S — CID 62960824
N-[(3-aminophenyl)methyl]-4-ethyl-N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 62960824) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-4-ethyl-N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-[(3-aminophenyl)methyl]-4-ethyl-N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62960824 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-4-ethyl-N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CCc1csc(N(Cc2cccc(N)c2)C(C)C)n1 |
| InChI | InChI=1S/C15H21N3S/c1-4-14-10-19-15(17-14)18(11(2)3)9-12-6-5-7-13(16)8-12/h5-8,10-11H,4,9,16H2,1-3H3 |
| InChIKey | BZUNWKSMRJCOEY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|