C14H19N3S — CID 60875705
N-[(4-aminophenyl)methyl]-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 60875705) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60875705 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-4-methyl-N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(N(Cc2ccc(N)cc2)C(C)C)n1 |
| InChI | InChI=1S/C14H19N3S/c1-10(2)17(14-16-11(3)9-18-14)8-12-4-6-13(15)7-5-12/h4-7,9-10H,8,15H2,1-3H3 |
| InChIKey | RWKKHTRZUCUTQR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|