C15H19N3OS — CID 62961907
N-[2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethyl]-4-methylbenzamide (PubChem CID 62961907) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 62961907 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[2-[(4-ethyl-1,3-thiazol-2-yl)amino]ethyl]-4-methylbenzamide |
| SMILES | CCc1csc(NCCNC(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C15H19N3OS/c1-3-13-10-20-15(18-13)17-9-8-16-14(19)12-6-4-11(2)5-7-12/h4-7,10H,3,8-9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | OGMHZUCDZRXOLG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|