C10H16N2OS — CID 62963555
4-ethyl-N-(oxolan-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 62963555) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 4-ethyl-N-(oxolan-3-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(oxolan-3-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62963555 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-ethyl-N-(oxolan-3-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCC2CCOC2)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-2-9-7-14-10(12-9)11-5-8-3-4-13-6-8/h7-8H,2-6H2,1H3,(H,11,12) |
| InChIKey | MWEBXPAYZLAHPR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |