C16H13F4N — CID 62964766
N-[[2-fluoro-4-(2,3,4-trifluorophenyl)phenyl]methyl]cyclopropanamine (PubChem CID 62964766) has the molecular formula C16H13F4N and a molecular weight of 295.28 g/mol. Its IUPAC name is N-[[2-fluoro-4-(2,3,4-trifluorophenyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-fluoro-4-(2,3,4-trifluorophenyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62964766 |
| Molecular Formula | C16H13F4N |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[[2-fluoro-4-(2,3,4-trifluorophenyl)phenyl]methyl]cyclopropanamine |
| SMILES | Fc1cc(-c2ccc(F)c(F)c2F)ccc1CNC1CC1 |
| InChI | InChI=1S/C16H13F4N/c17-13-6-5-12(15(19)16(13)20)9-1-2-10(14(18)7-9)8-21-11-3-4-11/h1-2,5-7,11,21H,3-4,8H2 |
| InChIKey | GMIBICCJRPFZHX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|