C13H25NO5 — CID 62965265
5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-3-methyl-5-oxopentanoic acid (PubChem CID 62965265) has the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. Its IUPAC name is 5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62965265 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-3-methyl-5-oxopentanoic acid |
| SMILES | COCCN(C(=O)CC(C)CC(=O)O)C(C)COC |
| InChI | InChI=1S/C13H25NO5/c1-10(8-13(16)17)7-12(15)14(5-6-18-3)11(2)9-19-4/h10-11H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | ATVDBLNHRHNEJH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |