C13H23F3N4 — CID 62967430
N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (PubChem CID 62967430) has the molecular formula C13H23F3N4 and a molecular weight of 292.35 g/mol. Its IUPAC name is N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
| Compound Name | N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 62967430 |
| Molecular Formula | C13H23F3N4 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\C1CCCCC1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N4/c14-13(15,16)10-19-6-8-20(9-7-19)12(17)18-11-4-2-1-3-5-11/h11H,1-10H2,(H2,17,18) |
| InChIKey | BTDNCBXRWIDKCW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|