C10H19F3N4 — CID 62967571
N'-propyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (PubChem CID 62967571) has the molecular formula C10H19F3N4 and a molecular weight of 252.28 g/mol. Its IUPAC name is N'-propyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
| Compound Name | N'-propyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 62967571 |
| Molecular Formula | C10H19F3N4 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N'-propyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| SMILES | CCC/N=C(\N)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N4/c1-2-3-15-9(14)17-6-4-16(5-7-17)8-10(11,12)13/h2-8H2,1H3,(H2,14,15) |
| InChIKey | QWORBXZTLDOYIQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|