4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid

C15H20N2O4 — CID 62968342

IUPAC4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid
SMILESO=C(O)c1ccc(CCNC(=O)N2CCCOCC2)cc1
InChIInChI=1S/C15H20N2O4/c18-14(19)13-4-2-12(3-5-13)6-7-16-15(20)17-8-1-10-21-11-9-17/h2-5H,1,6-11H2,(H,16,20)(H,18,19)
InChIKeyCDKDDFMCTOVHJT-UHFFFAOYSA-N
MW292.33 g/mol
LogP1.36
Rot. Bonds4

About 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid

4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid (PubChem CID 62968342) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid.

Molecular Properties

Compound Name4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid
PubChem CID62968342
Molecular FormulaC15H20N2O4
Molecular Weight292.33 g/mol
Exact Mass292.14
IUPAC Name4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid
SMILESO=C(O)c1ccc(CCNC(=O)N2CCCOCC2)cc1
InChIInChI=1S/C15H20N2O4/c18-14(19)13-4-2-12(3-5-13)6-7-16-15(20)17-8-1-10-21-11-9-17/h2-5H,1,6-11H2,(H,16,20)(H,18,19)
InChIKeyCDKDDFMCTOVHJT-UHFFFAOYSA-N
XLogP1.36
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.33
LogP ≤ 51.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid?
The IUPAC name of 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid (CID 62968342) is 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid.
What is the SMILES notation for 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid?
The canonical SMILES for 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid is O=C(O)c1ccc(CCNC(=O)N2CCCOCC2)cc1.
What is the InChIKey of 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid?
The InChIKey is CDKDDFMCTOVHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O4/c18-14(19)13-4-2-12(3-5-13)6-7-16-15(20)17-8-1-10-21-11-9-17/h2-5H,1,6-11H2,(H,16,20)(H,18,19).
What are the key properties of 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid?
4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid has a molecular weight of 292.33 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,4-oxazepane-4-carbonylamino)ethyl]benzoic acid is sourced from PubChem (CID 62968342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).