C15H18F2N2O3 — CID 166240238
4-[2-[(4,4-difluoropiperidine-1-carbonyl)amino]ethyl]benzoic acid (PubChem CID 166240238) has the molecular formula C15H18F2N2O3 and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-[2-[(4,4-difluoropiperidine-1-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[(4,4-difluoropiperidine-1-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 166240238 |
| Molecular Formula | C15H18F2N2O3 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-[2-[(4,4-difluoropiperidine-1-carbonyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNC(=O)N2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C15H18F2N2O3/c16-15(17)6-9-19(10-7-15)14(22)18-8-5-11-1-3-12(4-2-11)13(20)21/h1-4H,5-10H2,(H,18,22)(H,20,21) |
| InChIKey | KIWFHKGPTRYFGK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |