C12H12F2N2O3 — CID 168655298
4-[(3,3-difluoropyrrolidine-1-carbonyl)amino]benzoic acid (PubChem CID 168655298) has the molecular formula C12H12F2N2O3 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-[(3,3-difluoropyrrolidine-1-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(3,3-difluoropyrrolidine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 168655298 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 4-[(3,3-difluoropyrrolidine-1-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)N2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C12H12F2N2O3/c13-12(14)5-6-16(7-12)11(19)15-9-3-1-8(2-4-9)10(17)18/h1-4H,5-7H2,(H,15,19)(H,17,18) |
| InChIKey | JWVUNQJIASNAKU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |