C14H20N6 — CID 62977216
N'-cyclopropyl-N'-methyl-N-[(1-phenyltetrazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 62977216) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is N'-cyclopropyl-N'-methyl-N-[(1-phenyltetrazol-5-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N'-methyl-N-[(1-phenyltetrazol-5-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62977216 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N'-cyclopropyl-N'-methyl-N-[(1-phenyltetrazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | CN(CCNCc1nnnn1-c1ccccc1)C1CC1 |
| InChI | InChI=1S/C14H20N6/c1-19(12-7-8-12)10-9-15-11-14-16-17-18-20(14)13-5-3-2-4-6-13/h2-6,12,15H,7-11H2,1H3 |
| InChIKey | QBYPYXHSJYXOIL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|