C14H17ClN4 — CID 62979984
3-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]-N-methylpyrazin-2-amine (PubChem CID 62979984) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]-N-methylpyrazin-2-amine.
| Compound Name | 3-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 62979984 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]-N-methylpyrazin-2-amine |
| SMILES | CC(c1ccc(Cl)cc1)N(C)c1nccnc1CN |
| InChI | InChI=1S/C14H17ClN4/c1-10(11-3-5-12(15)6-4-11)19(2)14-13(9-16)17-7-8-18-14/h3-8,10H,9,16H2,1-2H3 |
| InChIKey | OFDXHECLFDHOJM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |