C12H12N4O2S — CID 62981381
N-(4-cyanophenyl)-N,1-dimethylpyrazole-4-sulfonamide (PubChem CID 62981381) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N,1-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-(4-cyanophenyl)-N,1-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62981381 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(4-cyanophenyl)-N,1-dimethylpyrazole-4-sulfonamide |
| SMILES | CN(c1ccc(C#N)cc1)S(=O)(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C12H12N4O2S/c1-15-9-12(8-14-15)19(17,18)16(2)11-5-3-10(7-13)4-6-11/h3-6,8-9H,1-2H3 |
| InChIKey | YDLKIADUYACWSR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |