C14H19N3O — CID 62982145
N-(4-cyanophenyl)-2-(ethylamino)-N,2-dimethylpropanamide (PubChem CID 62982145) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(ethylamino)-N,2-dimethylpropanamide.
| Compound Name | N-(4-cyanophenyl)-2-(ethylamino)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 62982145 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-(4-cyanophenyl)-2-(ethylamino)-N,2-dimethylpropanamide |
| SMILES | CCNC(C)(C)C(=O)N(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-5-16-14(2,3)13(18)17(4)12-8-6-11(10-15)7-9-12/h6-9,16H,5H2,1-4H3 |
| InChIKey | YBBSXNANDPBXKY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |