C13H17N3O — CID 79161464
1-(4-cyanophenyl)-3,3-diethyl-1-methylurea (PubChem CID 79161464) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3,3-diethyl-1-methylurea.
| Compound Name | 1-(4-cyanophenyl)-3,3-diethyl-1-methylurea |
|---|---|
| PubChem CID | 79161464 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-(4-cyanophenyl)-3,3-diethyl-1-methylurea |
| SMILES | CCN(CC)C(=O)N(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H17N3O/c1-4-16(5-2)13(17)15(3)12-8-6-11(10-14)7-9-12/h6-9H,4-5H2,1-3H3 |
| InChIKey | CPFLJHQSLBIUGX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |