C10H21N3O2S — CID 62982190
3-[(1-cyclopropylpyrrolidin-3-yl)amino]propane-1-sulfonamide (PubChem CID 62982190) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is 3-[(1-cyclopropylpyrrolidin-3-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(1-cyclopropylpyrrolidin-3-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 62982190 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-[(1-cyclopropylpyrrolidin-3-yl)amino]propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C10H21N3O2S/c11-16(14,15)7-1-5-12-9-4-6-13(8-9)10-2-3-10/h9-10,12H,1-8H2,(H2,11,14,15) |
| InChIKey | FMGIVAWADNJCNJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|