C11H20F3N3 — CID 79260589
N'-(1-cyclopropylpyrrolidin-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 79260589) has the molecular formula C11H20F3N3 and a molecular weight of 251.30 g/mol. Its IUPAC name is N'-(1-cyclopropylpyrrolidin-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-(1-cyclopropylpyrrolidin-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79260589 |
| Molecular Formula | C11H20F3N3 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N'-(1-cyclopropylpyrrolidin-3-yl)-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | FC(F)(F)CNCCNC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C11H20F3N3/c12-11(13,14)8-15-4-5-16-9-3-6-17(7-9)10-1-2-10/h9-10,15-16H,1-8H2 |
| InChIKey | VXVCFWMEWFHFKX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|