C12H28N2O — CID 62983591
4-N-ethyl-1-N-(3-methoxypropyl)-1-N-methylpentane-1,4-diamine (PubChem CID 62983591) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is 4-N-ethyl-1-N-(3-methoxypropyl)-1-N-methylpentane-1,4-diamine.
| Compound Name | 4-N-ethyl-1-N-(3-methoxypropyl)-1-N-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 62983591 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 4-N-ethyl-1-N-(3-methoxypropyl)-1-N-methylpentane-1,4-diamine |
| SMILES | CCNC(C)CCCN(C)CCCOC |
| InChI | InChI=1S/C12H28N2O/c1-5-13-12(2)8-6-9-14(3)10-7-11-15-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | ZNXLBQZKGDOBQB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|