C9H17N5O2 — CID 62984459
2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methoxypropyl)-N-methylacetamide (PubChem CID 62984459) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methoxypropyl)-N-methylacetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methoxypropyl)-N-methylacetamide |
|---|---|
| PubChem CID | 62984459 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methoxypropyl)-N-methylacetamide |
| SMILES | COCCCN(C)C(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C9H17N5O2/c1-13(4-3-5-16-2)8(15)6-14-7-11-9(10)12-14/h7H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | PNOZFXBJRRBKLJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|