C14H19FN2OS — CID 62984512
3-amino-N-[1-(2-fluorophenyl)ethyl]-N,2,2-trimethyl-3-sulfanylidenepropanamide (PubChem CID 62984512) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-amino-N-[1-(2-fluorophenyl)ethyl]-N,2,2-trimethyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-[1-(2-fluorophenyl)ethyl]-N,2,2-trimethyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 62984512 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-amino-N-[1-(2-fluorophenyl)ethyl]-N,2,2-trimethyl-3-sulfanylidenepropanamide |
| SMILES | CC(c1ccccc1F)N(C)C(=O)C(C)(C)C(N)=S |
| InChI | InChI=1S/C14H19FN2OS/c1-9(10-7-5-6-8-11(10)15)17(4)13(18)14(2,3)12(16)19/h5-9H,1-4H3,(H2,16,19) |
| InChIKey | RKNMVYXRUVHBBH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|