C10H20N2OS — CID 62986906
[3-(1,4-oxazepan-4-yl)thiolan-3-yl]methanamine (PubChem CID 62986906) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is [3-(1,4-oxazepan-4-yl)thiolan-3-yl]methanamine.
| Compound Name | [3-(1,4-oxazepan-4-yl)thiolan-3-yl]methanamine |
|---|---|
| PubChem CID | 62986906 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | [3-(1,4-oxazepan-4-yl)thiolan-3-yl]methanamine |
| SMILES | NCC1(N2CCCOCC2)CCSC1 |
| InChI | InChI=1S/C10H20N2OS/c11-8-10(2-7-14-9-10)12-3-1-5-13-6-4-12/h1-9,11H2 |
| InChIKey | XAONILNYNJLERB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |