C16H25FN2O — CID 62987204
1-(4-fluorophenyl)-1-(2-methyl-1,4-oxazepan-4-yl)butan-2-amine (PubChem CID 62987204) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-(2-methyl-1,4-oxazepan-4-yl)butan-2-amine.
| Compound Name | 1-(4-fluorophenyl)-1-(2-methyl-1,4-oxazepan-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 62987204 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-(4-fluorophenyl)-1-(2-methyl-1,4-oxazepan-4-yl)butan-2-amine |
| SMILES | CCC(N)C(c1ccc(F)cc1)N1CCCOC(C)C1 |
| InChI | InChI=1S/C16H25FN2O/c1-3-15(18)16(13-5-7-14(17)8-6-13)19-9-4-10-20-12(2)11-19/h5-8,12,15-16H,3-4,9-11,18H2,1-2H3 |
| InChIKey | VQCOHKATXFLUOZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |