C16H28N4O — CID 62994297
4-amino-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 62994297) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-amino-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62994297 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 4-amino-N-(2-methyl-3-pyrrolidin-1-ylpropyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(CNC(=O)c1cc(N)cn1C(C)C)CN1CCCC1 |
| InChI | InChI=1S/C16H28N4O/c1-12(2)20-11-14(17)8-15(20)16(21)18-9-13(3)10-19-6-4-5-7-19/h8,11-13H,4-7,9-10,17H2,1-3H3,(H,18,21) |
| InChIKey | CXOAEPUSILBHHL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |