C17H19FN2O — CID 62995433
3-(aminomethyl)-N-[1-(4-fluorophenyl)propan-2-yl]benzamide (PubChem CID 62995433) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[1-(4-fluorophenyl)propan-2-yl]benzamide.
| Compound Name | 3-(aminomethyl)-N-[1-(4-fluorophenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 62995433 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-(aminomethyl)-N-[1-(4-fluorophenyl)propan-2-yl]benzamide |
| SMILES | CC(Cc1ccc(F)cc1)NC(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C17H19FN2O/c1-12(9-13-5-7-16(18)8-6-13)20-17(21)15-4-2-3-14(10-15)11-19/h2-8,10,12H,9,11,19H2,1H3,(H,20,21) |
| InChIKey | HRRXCVPFHOAWFT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |