C11H15N3 — CID 62996928
3-[(6-methyl-3-pyridinyl)methylamino]butanenitrile (PubChem CID 62996928) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-[(6-methyl-3-pyridinyl)methylamino]butanenitrile.
| Compound Name | 3-[(6-methyl-3-pyridinyl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 62996928 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-[(6-methyl-3-pyridinyl)methylamino]butanenitrile |
| SMILES | Cc1ccc(CNC(C)CC#N)cn1 |
| InChI | InChI=1S/C11H15N3/c1-9-3-4-11(7-13-9)8-14-10(2)5-6-12/h3-4,7,10,14H,5,8H2,1-2H3 |
| InChIKey | KUQXQDAKNHQQSL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |