C10H16N4O — CID 77032579
N'-hydroxy-2-[(6-methyl-3-pyridinyl)methylamino]propanimidamide (PubChem CID 77032579) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is N'-hydroxy-2-[(6-methyl-3-pyridinyl)methylamino]propanimidamide.
| Compound Name | N'-hydroxy-2-[(6-methyl-3-pyridinyl)methylamino]propanimidamide |
|---|---|
| PubChem CID | 77032579 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N'-hydroxy-2-[(6-methyl-3-pyridinyl)methylamino]propanimidamide |
| SMILES | Cc1ccc(CNC(C)C(N)=NO)cn1 |
| InChI | InChI=1S/C10H16N4O/c1-7-3-4-9(5-12-7)6-13-8(2)10(11)14-15/h3-5,8,13,15H,6H2,1-2H3,(H2,11,14) |
| InChIKey | ZTZPNSZIDXYAGV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|