C16H22O2S — CID 62997171
1-(2,5-dimethylphenyl)-2-(oxan-4-ylsulfanyl)propan-1-one (PubChem CID 62997171) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(oxan-4-ylsulfanyl)propan-1-one.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(oxan-4-ylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 62997171 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(oxan-4-ylsulfanyl)propan-1-one |
| SMILES | Cc1ccc(C)c(C(=O)C(C)SC2CCOCC2)c1 |
| InChI | InChI=1S/C16H22O2S/c1-11-4-5-12(2)15(10-11)16(17)13(3)19-14-6-8-18-9-7-14/h4-5,10,13-14H,6-9H2,1-3H3 |
| InChIKey | YCYVZSCPWPAMOR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |